C17H28BNO4 — CID 56844776
(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]borinic acid (PubChem CID 56844776) has the molecular formula C17H28BNO4 and a molecular weight of 321.23 g/mol. Its IUPAC name is (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]borinic acid.
| Compound Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]borinic acid |
|---|---|
| PubChem CID | 56844776 |
| Molecular Formula | C17H28BNO4 |
| Molecular Weight | 321.23 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | (3-hydroxy-2,3-dimethylbutan-2-yl)oxy-[4-[2-oxo-2-(propan-2-ylamino)ethyl]phenyl]borinic acid |
| SMILES | CC(C)NC(=O)Cc1ccc(B(O)OC(C)(C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C17H28BNO4/c1-12(2)19-15(20)11-13-7-9-14(10-8-13)18(22)23-17(5,6)16(3,4)21/h7-10,12,21-22H,11H2,1-6H3,(H,19,20) |
| InChIKey | CSJUBMPCHYLABK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.23 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|