C13H25BO3 — CID 56845034
cyclohepten-1-yl-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid (PubChem CID 56845034) has the molecular formula C13H25BO3 and a molecular weight of 240.15 g/mol. Its IUPAC name is cyclohepten-1-yl-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid.
| Compound Name | cyclohepten-1-yl-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
|---|---|
| PubChem CID | 56845034 |
| Molecular Formula | C13H25BO3 |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | cyclohepten-1-yl-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyborinic acid |
| SMILES | CC(C)(O)C(C)(C)OB(O)C1=CCCCCC1 |
| InChI | InChI=1S/C13H25BO3/c1-12(2,15)13(3,4)17-14(16)11-9-7-5-6-8-10-11/h9,15-16H,5-8,10H2,1-4H3 |
| InChIKey | FTOHJKDWJHQXBO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|