C18H24N2O — CID 56845285
(2S,3R,5S)-2,5-diamino-1,6-diphenylhexan-3-ol (PubChem CID 56845285) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is (2S,3R,5S)-2,5-diamino-1,6-diphenylhexan-3-ol.
| Compound Name | (2S,3R,5S)-2,5-diamino-1,6-diphenylhexan-3-ol |
|---|---|
| PubChem CID | 56845285 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | (2S,3R,5S)-2,5-diamino-1,6-diphenylhexan-3-ol |
| SMILES | N[C@@H](Cc1ccccc1)C[C@@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O/c19-16(11-14-7-3-1-4-8-14)13-18(21)17(20)12-15-9-5-2-6-10-15/h1-10,16-18,21H,11-13,19-20H2/t16-,17-,18+/m0/s1 |
| InChIKey | BIZHLXOOWGXFLC-OKZBNKHCSA-N |
| XLogP | 1.88 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |