C20H32N2 — CID 56845538
(5S,7S)-3-[(5S,7S)-3-amino-1-adamantyl]adamantan-1-amine (PubChem CID 56845538) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is (5S,7S)-3-[(5S,7S)-3-amino-1-adamantyl]adamantan-1-amine.
| Compound Name | (5S,7S)-3-[(5S,7S)-3-amino-1-adamantyl]adamantan-1-amine |
|---|---|
| PubChem CID | 56845538 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | (5S,7S)-3-[(5S,7S)-3-amino-1-adamantyl]adamantan-1-amine |
| SMILES | NC12C[C@H]3C[C@H](C1)CC(C14C[C@@H]5C[C@H](CC(N)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C20H32N2/c21-19-7-13-1-14(8-19)4-17(3-13,11-19)18-5-15-2-16(6-18)10-20(22,9-15)12-18/h13-16H,1-12,21-22H2/t13-,14-,15-,16-,17?,18?,19?,20?/m0/s1 |
| InChIKey | SOKRCBPOBAYQBS-OSMCNATGSA-N |
| XLogP | 3.58 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |