C8H10O2 — CID 56845942
1,2,3,4-tetradeuterio-5,6-dimethoxybenzene (PubChem CID 56845942) has the molecular formula C8H10O2 and a molecular weight of 142.19 g/mol. Its IUPAC name is 1,2,3,4-tetradeuterio-5,6-dimethoxybenzene.
| Compound Name | 1,2,3,4-tetradeuterio-5,6-dimethoxybenzene |
|---|---|
| PubChem CID | 56845942 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 1,2,3,4-tetradeuterio-5,6-dimethoxybenzene |
| SMILES | [2H]c1c([2H])c([2H])c(OC)c(OC)c1[2H] |
| InChI | InChI=1S/C8H10O2/c1-9-7-5-3-4-6-8(7)10-2/h3-6H,1-2H3/i3D,4D,5D,6D |
| InChIKey | ABDKAPXRBAPSQN-LNFUJOGGSA-N |
| XLogP | 1.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |