About CID 56845958
CID 56845958 (PubChem CID 56845958) has the molecular formula C5H11BS-
and a molecular weight of 114.02 g/mol.
Molecular Properties
| Compound Name | CID 56845958 |
| PubChem CID | 56845958 |
| Molecular Formula | C5H11BS- |
| Molecular Weight | 114.02 g/mol |
| Exact Mass | 114.07 |
| IUPAC Name | — |
| SMILES | [B-]SCCC(C)C |
| InChI | InChI=1S/C5H11BS/c1-5(2)3-4-7-6/h5H,3-4H2,1-2H3/q-1 |
| InChIKey | FIHGDVMJPZJZQE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.02 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 56845958 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56845958?
The IUPAC name of CID 56845958 (CID 56845958) is not available.
What is the SMILES notation for CID 56845958?
The canonical SMILES for CID 56845958 is [B-]SCCC(C)C.
What is the InChIKey of CID 56845958?
The InChIKey is FIHGDVMJPZJZQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11BS/c1-5(2)3-4-7-6/h5H,3-4H2,1-2H3/q-1.
What are the key properties of CID 56845958?
CID 56845958 has a molecular weight of 114.02 g/mol, XLogP of 1.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56845958 is sourced from PubChem (CID 56845958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).