C9H13N — CID 56845993
1,1,1-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine (PubChem CID 56845993) has the molecular formula C9H13N and a molecular weight of 143.26 g/mol. Its IUPAC name is 1,1,1-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine.
| Compound Name | 1,1,1-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine |
|---|---|
| PubChem CID | 56845993 |
| Molecular Formula | C9H13N |
| Molecular Weight | 143.26 g/mol |
| Exact Mass | 143.16 |
| IUPAC Name | 1,1,1-trideuterio-3-(2,3,4,5,6-pentadeuteriophenyl)propan-2-amine |
| SMILES | [2H]c1c([2H])c([2H])c(CC(N)C([2H])([2H])[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/i1D3,2D,3D,4D,5D,6D |
| InChIKey | KWTSXDURSIMDCE-JGUCLWPXSA-N |
| XLogP | 1.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |