About 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one
3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one (PubChem CID 56846395) has the molecular formula C24H30O2
and a molecular weight of 350.50 g/mol. Its IUPAC name is 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one |
| PubChem CID | 56846395 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one |
| SMILES | CCCCc1c(-c2ccc(C)cc2C)ccc2c1C(CCCC)C(=O)O2 |
| InChI | InChI=1S/C24H30O2/c1-5-7-9-20-19(18-12-11-16(3)15-17(18)4)13-14-22-23(20)21(10-8-6-2)24(25)26-22/h11-15,21H,5-10H2,1-4H3 |
| InChIKey | BNAOQKULFPHAHL-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one?
The IUPAC name of 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one (CID 56846395) is 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one.
What is the SMILES notation for 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one?
The canonical SMILES for 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one is CCCCc1c(-c2ccc(C)cc2C)ccc2c1C(CCCC)C(=O)O2.
What is the InChIKey of 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one?
The InChIKey is BNAOQKULFPHAHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30O2/c1-5-7-9-20-19(18-12-11-16(3)15-17(18)4)13-14-22-23(20)21(10-8-6-2)24(25)26-22/h11-15,21H,5-10H2,1-4H3.
What are the key properties of 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one?
3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one has a molecular weight of 350.50 g/mol, XLogP of 6.51, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibutyl-5-(2,4-dimethylphenyl)-3H-1-benzofuran-2-one is sourced from PubChem (CID 56846395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).