C48H66N6 — CID 56846457
2,3-dimethylaniline;2,4-dimethylaniline;2,5-dimethylaniline;2,6-dimethylaniline;3,4-dimethylaniline;3,5-dimethylaniline (PubChem CID 56846457) has the molecular formula C48H66N6 and a molecular weight of 727.10 g/mol. Its IUPAC name is 2,3-dimethylaniline;2,4-dimethylaniline;2,5-dimethylaniline;2,6-dimethylaniline;3,4-dimethylaniline;3,5-dimethylaniline.
| Compound Name | 2,3-dimethylaniline;2,4-dimethylaniline;2,5-dimethylaniline;2,6-dimethylaniline;3,4-dimethylaniline;3,5-dimethylaniline |
|---|---|
| PubChem CID | 56846457 |
| Molecular Formula | C48H66N6 |
| Molecular Weight | 727.10 g/mol |
| Exact Mass | 726.53 |
| IUPAC Name | 2,3-dimethylaniline;2,4-dimethylaniline;2,5-dimethylaniline;2,6-dimethylaniline;3,4-dimethylaniline;3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(N)c1.Cc1ccc(C)c(N)c1.Cc1ccc(N)c(C)c1.Cc1ccc(N)cc1C.Cc1cccc(C)c1N.Cc1cccc(N)c1C |
| InChI | InChI=1S/6C8H11N/c1-6-3-7(2)5-8(9)4-6;1-6-3-4-8(9)5-7(6)2;1-6-3-4-8(9)7(2)5-6;1-6-3-4-7(2)8(9)5-6;1-6-4-3-5-8(9)7(6)2;1-6-4-3-5-7(2)8(6)9/h6*3-5H,9H2,1-2H3 |
| InChIKey | CDULGHZNHURECF-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.10 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|