About calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate
calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate (PubChem CID 56846586) has the molecular formula C7H11CaO5+
and a molecular weight of 215.24 g/mol. Its IUPAC name is calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate.
Molecular Properties
| Compound Name | calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate |
| PubChem CID | 56846586 |
| Molecular Formula | C7H11CaO5+ |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate |
| SMILES | CC1(C)OCC([C@@H](O)C(=O)[O-])O1.[Ca+2] |
| InChI | InChI=1S/C7H12O5.Ca/c1-7(2)11-3-4(12-7)5(8)6(9)10;/h4-5,8H,3H2,1-2H3,(H,9,10);/q;+2/p-1/t4?,5-;/m1./s1 |
| InChIKey | YLIZBJBJZOHVIU-VVNPLDQHSA-M |
| XLogP | -2.13 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
The IUPAC name of calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate (CID 56846586) is calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate.
What is the SMILES notation for calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
The canonical SMILES for calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate is CC1(C)OCC([C@@H](O)C(=O)[O-])O1.[Ca+2].
What is the InChIKey of calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
The InChIKey is YLIZBJBJZOHVIU-VVNPLDQHSA-M. The full InChI is InChI=1S/C7H12O5.Ca/c1-7(2)11-3-4(12-7)5(8)6(9)10;/h4-5,8H,3H2,1-2H3,(H,9,10);/q;+2/p-1/t4?,5-;/m1./s1.
What are the key properties of calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate?
calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate has a molecular weight of 215.24 g/mol, XLogP of -2.13, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium (2R)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate is sourced from PubChem (CID 56846586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).