C19H21N3O — CID 56846662
3,7,7-trimethyl-4-phenyl-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one (PubChem CID 56846662) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 3,7,7-trimethyl-4-phenyl-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 3,7,7-trimethyl-4-phenyl-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 56846662 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3,7,7-trimethyl-4-phenyl-4,4a,6,8-tetrahydro-2H-pyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1[nH]nc2c1C(c1ccccc1)C1C(=O)CC(C)(C)CC1=N2 |
| InChI | InChI=1S/C19H21N3O/c1-11-15-16(12-7-5-4-6-8-12)17-13(20-18(15)22-21-11)9-19(2,3)10-14(17)23/h4-8,16-17H,9-10H2,1-3H3,(H,21,22) |
| InChIKey | MKQSLJWIQQQJNN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |