C16H14F3N3O4S — CID 56847162
N-hydroxy-6-[4-(trifluoromethyl)phenyl]sulfonyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide (PubChem CID 56847162) has the molecular formula C16H14F3N3O4S and a molecular weight of 401.37 g/mol. Its IUPAC name is N-hydroxy-6-[4-(trifluoromethyl)phenyl]sulfonyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide.
| Compound Name | N-hydroxy-6-[4-(trifluoromethyl)phenyl]sulfonyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 56847162 |
| Molecular Formula | C16H14F3N3O4S |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | N-hydroxy-6-[4-(trifluoromethyl)phenyl]sulfonyl-7,8-dihydro-5H-1,6-naphthyridine-2-carboxamide |
| SMILES | O=C(NO)c1ccc2c(n1)CCN(S(=O)(=O)c1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C16H14F3N3O4S/c17-16(18,19)11-2-4-12(5-3-11)27(25,26)22-8-7-13-10(9-22)1-6-14(20-13)15(23)21-24/h1-6,24H,7-9H2,(H,21,23) |
| InChIKey | YMLDVNXNMOVUJV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|