C20H19N5O5S — CID 56847517
[2-[2-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]phenyl] methanesulfonate (PubChem CID 56847517) has the molecular formula C20H19N5O5S and a molecular weight of 441.47 g/mol. Its IUPAC name is [2-[2-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]phenyl] methanesulfonate.
| Compound Name | [2-[2-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 56847517 |
| Molecular Formula | C20H19N5O5S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | [2-[2-(3,5-dimethoxyanilino)-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]phenyl] methanesulfonate |
| SMILES | COc1cc(Nc2nc3c(-c4ccccc4OS(C)(=O)=O)nccn3n2)cc(OC)c1 |
| InChI | InChI=1S/C20H19N5O5S/c1-28-14-10-13(11-15(12-14)29-2)22-20-23-19-18(21-8-9-25(19)24-20)16-6-4-5-7-17(16)30-31(3,26)27/h4-12H,1-3H3,(H,22,24) |
| InChIKey | CDUKRJPTRUSMGM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|