C32H30F3N3O4 — CID 56847843
4-[2-oxo-8-[[1-propan-2-yl-5-(2,3,4-trifluorophenyl)indol-3-yl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]benzoic acid (PubChem CID 56847843) has the molecular formula C32H30F3N3O4 and a molecular weight of 577.60 g/mol. Its IUPAC name is 4-[2-oxo-8-[[1-propan-2-yl-5-(2,3,4-trifluorophenyl)indol-3-yl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]benzoic acid.
| Compound Name | 4-[2-oxo-8-[[1-propan-2-yl-5-(2,3,4-trifluorophenyl)indol-3-yl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 56847843 |
| Molecular Formula | C32H30F3N3O4 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 4-[2-oxo-8-[[1-propan-2-yl-5-(2,3,4-trifluorophenyl)indol-3-yl]methyl]-1-oxa-3,8-diazaspiro[4.5]decan-3-yl]benzoic acid |
| SMILES | CC(C)n1cc(CN2CCC3(CC2)CN(c2ccc(C(=O)O)cc2)C(=O)O3)c2cc(-c3ccc(F)c(F)c3F)ccc21 |
| InChI | InChI=1S/C32H30F3N3O4/c1-19(2)37-17-22(25-15-21(5-10-27(25)37)24-8-9-26(33)29(35)28(24)34)16-36-13-11-32(12-14-36)18-38(31(41)42-32)23-6-3-20(4-7-23)30(39)40/h3-10,15,17,19H,11-14,16,18H2,1-2H3,(H,39,40) |
| InChIKey | MVWDXCYLLBYTQK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|