C25H23ClN4 — CID 56848109
1-(4-chlorophenyl)-5-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene (PubChem CID 56848109) has the molecular formula C25H23ClN4 and a molecular weight of 414.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene.
| Compound Name | 1-(4-chlorophenyl)-5-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 56848109 |
| Molecular Formula | C25H23ClN4 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-(4-chlorophenyl)-5-(3-methyl-[1,2,4]triazolo[4,3-a]pyridin-6-yl)-9-azatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene |
| SMILES | Cc1nnc2ccc(-c3ccc4c(c3)CN3CCC4(c4ccc(Cl)cc4)CC3)cn12 |
| InChI | InChI=1S/C25H23ClN4/c1-17-27-28-24-9-3-19(16-30(17)24)18-2-8-23-20(14-18)15-29-12-10-25(23,11-13-29)21-4-6-22(26)7-5-21/h2-9,14,16H,10-13,15H2,1H3 |
| InChIKey | KWGNNADVFYRCOK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |