C17H16F2N4OS — CID 56848197
N-[5-(1,3-diethylpyrazol-5-yl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide (PubChem CID 56848197) has the molecular formula C17H16F2N4OS and a molecular weight of 362.41 g/mol. Its IUPAC name is N-[5-(1,3-diethylpyrazol-5-yl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(1,3-diethylpyrazol-5-yl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 56848197 |
| Molecular Formula | C17H16F2N4OS |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[5-(1,3-diethylpyrazol-5-yl)-1,3-thiazol-2-yl]-2,6-difluorobenzamide |
| SMILES | CCc1cc(-c2cnc(NC(=O)c3c(F)cccc3F)s2)n(CC)n1 |
| InChI | InChI=1S/C17H16F2N4OS/c1-3-10-8-13(23(4-2)22-10)14-9-20-17(25-14)21-16(24)15-11(18)6-5-7-12(15)19/h5-9H,3-4H2,1-2H3,(H,20,21,24) |
| InChIKey | NRRNEYMOSYOHHP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |