C19H25N7O3S — CID 56848891
N-(2-methoxyethyl)-6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide (PubChem CID 56848891) has the molecular formula C19H25N7O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 56848891 |
| Molecular Formula | C19H25N7O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-(2-methoxyethyl)-6-[methyl-[(3R)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrolidin-3-yl]amino]pyridine-3-sulfonamide |
| SMILES | COCCNS(=O)(=O)c1ccc(N(C)[C@@H]2CCN(c3ncnc4[nH]ccc34)C2)nc1 |
| InChI | InChI=1S/C19H25N7O3S/c1-25(17-4-3-15(11-21-17)30(27,28)24-8-10-29-2)14-6-9-26(12-14)19-16-5-7-20-18(16)22-13-23-19/h3-5,7,11,13-14,24H,6,8-10,12H2,1-2H3,(H,20,22,23)/t14-/m1/s1 |
| InChIKey | PAZWAMVAKGTXCG-CQSZACIVSA-N |
| XLogP | 0.99 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|