C28H32N6O6S — CID 56848899
4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-hydroxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide (PubChem CID 56848899) has the molecular formula C28H32N6O6S and a molecular weight of 580.67 g/mol. Its IUPAC name is 4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-hydroxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide.
| Compound Name | 4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-hydroxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 56848899 |
| Molecular Formula | C28H32N6O6S |
| Molecular Weight | 580.67 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-hydroxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide |
| SMILES | COCCOC1(C(=O)NO)CCC(c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N)c2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C28H32N6O6S/c1-39-14-15-40-28(27(35)33-36)12-10-19(11-13-28)23-24(41(2,37)38)25(29)34-26(32-23)21(17-31-34)20-8-9-22(30-16-20)18-6-4-3-5-7-18/h3-9,16-17,19,36H,10-15,29H2,1-2H3,(H,33,35) |
| InChIKey | CZMLAYOFHOOBMT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 171.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|