C29H34N6O6S — CID 56848900
4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-methoxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide (PubChem CID 56848900) has the molecular formula C29H34N6O6S and a molecular weight of 594.69 g/mol. Its IUPAC name is 4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-methoxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide.
| Compound Name | 4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-methoxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 56848900 |
| Molecular Formula | C29H34N6O6S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | 4-[7-amino-6-methylsulfonyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-N-methoxy-1-(2-methoxyethoxy)cyclohexane-1-carboxamide |
| SMILES | COCCOC1(C(=O)NOC)CCC(c2nc3c(-c4ccc(-c5ccccc5)nc4)cnn3c(N)c2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C29H34N6O6S/c1-39-15-16-41-29(28(36)34-40-2)13-11-20(12-14-29)24-25(42(3,37)38)26(30)35-27(33-24)22(18-32-35)21-9-10-23(31-17-21)19-7-5-4-6-8-19/h4-10,17-18,20H,11-16,30H2,1-3H3,(H,34,36) |
| InChIKey | XOKUOJQTNNMBRG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 160.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|