C37H34ClF6N7O7S2 — CID 56848980
2-[4-[2-(azetidin-1-yl)-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 56848980) has the molecular formula C37H34ClF6N7O7S2 and a molecular weight of 902.30 g/mol. Its IUPAC name is 2-[4-[2-(azetidin-1-yl)-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[4-[2-(azetidin-1-yl)-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 56848980 |
| Molecular Formula | C37H34ClF6N7O7S2 |
| Molecular Weight | 902.30 g/mol |
| Exact Mass | 901.16 |
| IUPAC Name | 2-[4-[2-(azetidin-1-yl)-6-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-3,5-dicyano-4-pyridinyl]phenoxy]ethyl (2S)-2,5-diaminopentanoate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | N#Cc1c(SCc2csc(-c3ccc(Cl)cc3)n2)nc(N2CCC2)c(C#N)c1-c1ccc(OCCOC(=O)[C@@H](N)CCCN)cc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C33H32ClN7O3S2.2C2HF3O2/c34-23-8-4-22(5-9-23)31-39-24(19-45-31)20-46-32-27(18-37)29(26(17-36)30(40-32)41-13-2-14-41)21-6-10-25(11-7-21)43-15-16-44-33(42)28(38)3-1-12-35;2*3-2(4,5)1(6)7/h4-11,19,28H,1-3,12-16,20,35,38H2;2*(H,6,7)/t28-;;/m0../s1 |
| InChIKey | JLZDGLMGJKAQGZ-ZXVJYWQYSA-N |
| XLogP | 7.03 |
| TPSA | 238.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.30 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|