C16H26O6 — CID 56849448
2-[(2S,3S,6S)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-(methoxymethoxy)-3,6-dihydro-2H-pyran-2-yl]acetic acid (PubChem CID 56849448) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 2-[(2S,3S,6S)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-(methoxymethoxy)-3,6-dihydro-2H-pyran-2-yl]acetic acid.
| Compound Name | 2-[(2S,3S,6S)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-(methoxymethoxy)-3,6-dihydro-2H-pyran-2-yl]acetic acid |
|---|---|
| PubChem CID | 56849448 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-[(2S,3S,6S)-6-[(E,6S)-6-hydroxyhept-1-enyl]-3-(methoxymethoxy)-3,6-dihydro-2H-pyran-2-yl]acetic acid |
| SMILES | COCO[C@H]1C=C[C@H](/C=C/CCC[C@H](C)O)O[C@H]1CC(=O)O |
| InChI | InChI=1S/C16H26O6/c1-12(17)6-4-3-5-7-13-8-9-14(21-11-20-2)15(22-13)10-16(18)19/h5,7-9,12-15,17H,3-4,6,10-11H2,1-2H3,(H,18,19)/b7-5+/t12-,13-,14-,15-/m0/s1 |
| InChIKey | YCZDMOIMJIYMHC-VPYOVWLTSA-N |
| XLogP | 1.88 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|