C28H49N5O7 — CID 56849696
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-N-[(2S)-1-cyclohexyl-3-oxopropan-2-yl]-4-methylpentanamide (PubChem CID 56849696) has the molecular formula C28H49N5O7 and a molecular weight of 567.73 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-N-[(2S)-1-cyclohexyl-3-oxopropan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-N-[(2S)-1-cyclohexyl-3-oxopropan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 56849696 |
| Molecular Formula | C28H49N5O7 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.36 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-3-hydroxypropanoyl]amino]propanoyl]amino]-3-methylbutanoyl]amino]-N-[(2S)-1-cyclohexyl-3-oxopropan-2-yl]-4-methylpentanamide |
| SMILES | CC(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CC1CCCCC1)C(C)C |
| InChI | InChI=1S/C28H49N5O7/c1-16(2)12-22(26(38)31-21(14-34)13-20-10-8-7-9-11-20)32-28(40)24(17(3)4)33-25(37)18(5)29-27(39)23(15-35)30-19(6)36/h14,16-18,20-24,35H,7-13,15H2,1-6H3,(H,29,39)(H,30,36)(H,31,38)(H,32,40)(H,33,37)/t18-,21-,22-,23-,24-/m0/s1 |
| InChIKey | QJDVBNNDENLRSC-NHKCCNDQSA-N |
| XLogP | 0.31 |
| TPSA | 182.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|