C19H26N6O2S — CID 56849713
3-(benzenesulfonyl)-7-N-[3-(dimethylamino)propyl]-2-N,5-dimethylpyrazolo[1,5-a]pyrimidine-2,7-diamine (PubChem CID 56849713) has the molecular formula C19H26N6O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-7-N-[3-(dimethylamino)propyl]-2-N,5-dimethylpyrazolo[1,5-a]pyrimidine-2,7-diamine.
| Compound Name | 3-(benzenesulfonyl)-7-N-[3-(dimethylamino)propyl]-2-N,5-dimethylpyrazolo[1,5-a]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 56849713 |
| Molecular Formula | C19H26N6O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-(benzenesulfonyl)-7-N-[3-(dimethylamino)propyl]-2-N,5-dimethylpyrazolo[1,5-a]pyrimidine-2,7-diamine |
| SMILES | CNc1nn2c(NCCCN(C)C)cc(C)nc2c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N6O2S/c1-14-13-16(21-11-8-12-24(3)4)25-19(22-14)17(18(20-2)23-25)28(26,27)15-9-6-5-7-10-15/h5-7,9-10,13,21H,8,11-12H2,1-4H3,(H,20,23) |
| InChIKey | DTCZEHDYOWMQLH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|