C21H31NO5Si — CID 56849816
1-O-benzyl 6-O-methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyridine-1,6-dicarboxylate (PubChem CID 56849816) has the molecular formula C21H31NO5Si and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-O-benzyl 6-O-methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyridine-1,6-dicarboxylate.
| Compound Name | 1-O-benzyl 6-O-methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 56849816 |
| Molecular Formula | C21H31NO5Si |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-O-benzyl 6-O-methyl (4R)-4-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
| SMILES | COC(=O)C1=C[C@H](O[Si](C)(C)C(C)(C)C)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H31NO5Si/c1-21(2,3)28(5,6)27-17-12-13-22(18(14-17)19(23)25-4)20(24)26-15-16-10-8-7-9-11-16/h7-11,14,17H,12-13,15H2,1-6H3/t17-/m1/s1 |
| InChIKey | VUFLRKPRXFDJRY-QGZVFWFLSA-N |
| XLogP | 4.48 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|