C10H13F3O4 — CID 56849939
ethyl (3aS,5S,6aR)-5-(trifluoromethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-carboxylate (PubChem CID 56849939) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is ethyl (3aS,5S,6aR)-5-(trifluoromethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-carboxylate.
| Compound Name | ethyl (3aS,5S,6aR)-5-(trifluoromethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-carboxylate |
|---|---|
| PubChem CID | 56849939 |
| Molecular Formula | C10H13F3O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | ethyl (3aS,5S,6aR)-5-(trifluoromethyl)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5-carboxylate |
| SMILES | CCOC(=O)[C@]1(C(F)(F)F)C[C@@H]2CCO[C@@H]2O1 |
| InChI | InChI=1S/C10H13F3O4/c1-2-15-8(14)9(10(11,12)13)5-6-3-4-16-7(6)17-9/h6-7H,2-5H2,1H3/t6-,7+,9-/m0/s1 |
| InChIKey | HFUXLZGJUJNVTM-OOZYFLPDSA-N |
| XLogP | 1.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |