C12H18O6 — CID 56849940
diethyl (3aS,6aR)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5,5-dicarboxylate (PubChem CID 56849940) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is diethyl (3aS,6aR)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5,5-dicarboxylate.
| Compound Name | diethyl (3aS,6aR)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5,5-dicarboxylate |
|---|---|
| PubChem CID | 56849940 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | diethyl (3aS,6aR)-3,3a,4,6a-tetrahydro-2H-furo[2,3-b]furan-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2CCO[C@@H]2O1 |
| InChI | InChI=1S/C12H18O6/c1-3-15-10(13)12(11(14)16-4-2)7-8-5-6-17-9(8)18-12/h8-9H,3-7H2,1-2H3/t8-,9+/m0/s1 |
| InChIKey | GHQAMHVERWJPBY-DTWKUNHWSA-N |
| XLogP | 0.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|