C12H9F5O2 — CID 56849941
(3aS,5R,6aR)-5-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan (PubChem CID 56849941) has the molecular formula C12H9F5O2 and a molecular weight of 280.19 g/mol. Its IUPAC name is (3aS,5R,6aR)-5-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan.
| Compound Name | (3aS,5R,6aR)-5-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
|---|---|
| PubChem CID | 56849941 |
| Molecular Formula | C12H9F5O2 |
| Molecular Weight | 280.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (3aS,5R,6aR)-5-(2,3,4,5,6-pentafluorophenyl)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan |
| SMILES | Fc1c(F)c(F)c([C@H]2C[C@@H]3CCO[C@@H]3O2)c(F)c1F |
| InChI | InChI=1S/C12H9F5O2/c13-7-6(8(14)10(16)11(17)9(7)15)5-3-4-1-2-18-12(4)19-5/h4-5,12H,1-3H2/t4-,5+,12+/m0/s1 |
| InChIKey | YGPLCROCTIMSIW-CCPMWVOFSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|