C27H35NO2 — CID 56850434
(E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-pyridin-2-ylprop-2-en-1-one (PubChem CID 56850434) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is (E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-pyridin-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-pyridin-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 56850434 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | (E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-pyridin-2-ylprop-2-en-1-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2C(=O)/C=C/c1ccccn1 |
| InChI | InChI=1S/C27H35NO2/c1-26-14-12-20(29)17-18(26)6-8-21-22-9-10-24(27(22,2)15-13-23(21)26)25(30)11-7-19-5-3-4-16-28-19/h3-7,11,16,20-24,29H,8-10,12-15,17H2,1-2H3/b11-7+/t20-,21-,22-,23-,24+,26-,27-/m0/s1 |
| InChIKey | LYRLKCOSYRYHQM-PLPGSINXSA-N |
| XLogP | 5.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|