C15H22ClN3O2S — CID 56850516
2-[4-(thiophen-2-ylmethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride (PubChem CID 56850516) has the molecular formula C15H22ClN3O2S and a molecular weight of 343.88 g/mol. Its IUPAC name is 2-[4-(thiophen-2-ylmethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride.
| Compound Name | 2-[4-(thiophen-2-ylmethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 56850516 |
| Molecular Formula | C15H22ClN3O2S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[4-(thiophen-2-ylmethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1C2CCCN2C(=O)N1CCCCNCc1cccs1 |
| InChI | InChI=1S/C15H21N3O2S.ClH/c19-14-13-6-3-9-17(13)15(20)18(14)8-2-1-7-16-11-12-5-4-10-21-12;/h4-5,10,13,16H,1-3,6-9,11H2;1H |
| InChIKey | DAIRZKTXXRKMIK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|