C19H26ClN3O3S — CID 56850662
6-[4-(3,4-dihydro-2H-chromen-2-ylmethylamino)butyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione;hydrochloride (PubChem CID 56850662) has the molecular formula C19H26ClN3O3S and a molecular weight of 411.96 g/mol. Its IUPAC name is 6-[4-(3,4-dihydro-2H-chromen-2-ylmethylamino)butyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione;hydrochloride.
| Compound Name | 6-[4-(3,4-dihydro-2H-chromen-2-ylmethylamino)butyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione;hydrochloride |
|---|---|
| PubChem CID | 56850662 |
| Molecular Formula | C19H26ClN3O3S |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 6-[4-(3,4-dihydro-2H-chromen-2-ylmethylamino)butyl]-3,7a-dihydro-1H-imidazo[1,5-c][1,3]thiazole-5,7-dione;hydrochloride |
| SMILES | Cl.O=C1C2CSCN2C(=O)N1CCCCNCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C19H25N3O3S.ClH/c23-18-16-12-26-13-22(16)19(24)21(18)10-4-3-9-20-11-15-8-7-14-5-1-2-6-17(14)25-15;/h1-2,5-6,15-16,20H,3-4,7-13H2;1H |
| InChIKey | HMCSAXHALXARAI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|