C21H30ClN3O3 — CID 56850795
2-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride (PubChem CID 56850795) has the molecular formula C21H30ClN3O3 and a molecular weight of 407.94 g/mol. Its IUPAC name is 2-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride.
| Compound Name | 2-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 56850795 |
| Molecular Formula | C21H30ClN3O3 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 2-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1C2CCCN2C(=O)N1CCCCCNCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C21H29N3O3.ClH/c25-20-18-8-6-14-23(18)21(26)24(20)13-5-1-4-12-22-15-17-11-10-16-7-2-3-9-19(16)27-17;/h2-3,7,9,17-18,22H,1,4-6,8,10-15H2;1H |
| InChIKey | YMIWBGLSLDTUBW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|