C24H36ClN3O3 — CID 56850798
2-[8-(3,4-dihydro-2H-chromen-2-ylmethylamino)octyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride (PubChem CID 56850798) has the molecular formula C24H36ClN3O3 and a molecular weight of 450.02 g/mol. Its IUPAC name is 2-[8-(3,4-dihydro-2H-chromen-2-ylmethylamino)octyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride.
| Compound Name | 2-[8-(3,4-dihydro-2H-chromen-2-ylmethylamino)octyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 56850798 |
| Molecular Formula | C24H36ClN3O3 |
| Molecular Weight | 450.02 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 2-[8-(3,4-dihydro-2H-chromen-2-ylmethylamino)octyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1C2CCCN2C(=O)N1CCCCCCCCNCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C24H35N3O3.ClH/c28-23-21-11-9-17-26(21)24(29)27(23)16-8-4-2-1-3-7-15-25-18-20-14-13-19-10-5-6-12-22(19)30-20;/h5-6,10,12,20-21,25H,1-4,7-9,11,13-18H2;1H |
| InChIKey | MDTMMOSYMIBHOL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.02 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|