C16H16Cl2N2O3 — CID 56850824
N-(3,5-dichloro-4-pyridinyl)-3,4-diethoxybenzamide (PubChem CID 56850824) has the molecular formula C16H16Cl2N2O3 and a molecular weight of 355.22 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-3,4-diethoxybenzamide.
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 56850824 |
| Molecular Formula | C16H16Cl2N2O3 |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)Nc2c(Cl)cncc2Cl)cc1OCC |
| InChI | InChI=1S/C16H16Cl2N2O3/c1-3-22-13-6-5-10(7-14(13)23-4-2)16(21)20-15-11(17)8-19-9-12(15)18/h5-9H,3-4H2,1-2H3,(H,19,20,21) |
| InChIKey | BBJKNVBIXYAKII-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |