C18H25ClN2O3S — CID 56850923
3-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 56850923) has the molecular formula C18H25ClN2O3S and a molecular weight of 384.93 g/mol. Its IUPAC name is 3-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 56850923 |
| Molecular Formula | C18H25ClN2O3S |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-[5-(3,4-dihydro-2H-chromen-2-ylmethylamino)pentyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1CSC(=O)N1CCCCCNCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C18H24N2O3S.ClH/c21-17-13-24-18(22)20(17)11-5-1-4-10-19-12-15-9-8-14-6-2-3-7-16(14)23-15;/h2-3,6-7,15,19H,1,4-5,8-13H2;1H |
| InChIKey | VNGMRVUHEZPTFD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|