C19H27ClN2O3S — CID 56850925
3-[6-(3,4-dihydro-2H-chromen-2-ylmethylamino)hexyl]-1,3-thiazolidine-2,4-dione;hydrochloride (PubChem CID 56850925) has the molecular formula C19H27ClN2O3S and a molecular weight of 398.96 g/mol. Its IUPAC name is 3-[6-(3,4-dihydro-2H-chromen-2-ylmethylamino)hexyl]-1,3-thiazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[6-(3,4-dihydro-2H-chromen-2-ylmethylamino)hexyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 56850925 |
| Molecular Formula | C19H27ClN2O3S |
| Molecular Weight | 398.96 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-[6-(3,4-dihydro-2H-chromen-2-ylmethylamino)hexyl]-1,3-thiazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.O=C1CSC(=O)N1CCCCCCNCC1CCc2ccccc2O1 |
| InChI | InChI=1S/C19H26N2O3S.ClH/c22-18-14-25-19(23)21(18)12-6-2-1-5-11-20-13-16-10-9-15-7-3-4-8-17(15)24-16;/h3-4,7-8,16,20H,1-2,5-6,9-14H2;1H |
| InChIKey | ZQFYAHGRZCKOAU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.96 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|