C21H17Br2N3O2 — CID 56851222
3-N,5-N-bis(3-bromophenyl)-2,6-dimethylpyridine-3,5-dicarboxamide (PubChem CID 56851222) has the molecular formula C21H17Br2N3O2 and a molecular weight of 503.19 g/mol. Its IUPAC name is 3-N,5-N-bis(3-bromophenyl)-2,6-dimethylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(3-bromophenyl)-2,6-dimethylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 56851222 |
| Molecular Formula | C21H17Br2N3O2 |
| Molecular Weight | 503.19 g/mol |
| Exact Mass | 500.97 |
| IUPAC Name | 3-N,5-N-bis(3-bromophenyl)-2,6-dimethylpyridine-3,5-dicarboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2cccc(Br)c2)cc1C(=O)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C21H17Br2N3O2/c1-12-18(20(27)25-16-7-3-5-14(22)9-16)11-19(13(2)24-12)21(28)26-17-8-4-6-15(23)10-17/h3-11H,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | WZRMIMOSOAVUSL-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.19 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |