C10H18O4S — CID 56851307
methyl 3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]propanoate (PubChem CID 56851307) has the molecular formula C10H18O4S and a molecular weight of 234.32 g/mol. Its IUPAC name is methyl 3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]propanoate.
| Compound Name | methyl 3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 56851307 |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | methyl 3-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methylsulfanyl]propanoate |
| SMILES | COC(=O)CCSC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C10H18O4S/c1-10(2)13-6-8(14-10)7-15-5-4-9(11)12-3/h8H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | FDLROZPEWOTUFJ-MRVPVSSYSA-N |
| XLogP | 1.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|