C18H29NO4 — CID 56851359
ethyl (Z)-3-[(4R,5S,7R)-7-(2-ethoxy-2-oxoethyl)-6-azaspiro[4.5]decan-4-yl]prop-2-enoate (PubChem CID 56851359) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is ethyl (Z)-3-[(4R,5S,7R)-7-(2-ethoxy-2-oxoethyl)-6-azaspiro[4.5]decan-4-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4R,5S,7R)-7-(2-ethoxy-2-oxoethyl)-6-azaspiro[4.5]decan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 56851359 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | ethyl (Z)-3-[(4R,5S,7R)-7-(2-ethoxy-2-oxoethyl)-6-azaspiro[4.5]decan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\[C@H]1CCC[C@]12CCC[C@H](CC(=O)OCC)N2 |
| InChI | InChI=1S/C18H29NO4/c1-3-22-16(20)10-9-14-7-5-11-18(14)12-6-8-15(19-18)13-17(21)23-4-2/h9-10,14-15,19H,3-8,11-13H2,1-2H3/b10-9-/t14-,15-,18+/m1/s1 |
| InChIKey | DUYUTXDYOSDIJZ-WNLRDRQSSA-N |
| XLogP | 2.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|