About 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate
1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate (PubChem CID 56851413) has the molecular formula C21H24O6
and a molecular weight of 372.42 g/mol. Its IUPAC name is 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate.
Molecular Properties
| Compound Name | 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate |
| PubChem CID | 56851413 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate |
| SMILES | CCOC(=O)C(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)OC12CCCC2 |
| InChI | InChI=1S/C21H24O6/c1-5-25-19(23)20(24)26-17-16(15-13(3)10-12(2)11-14(15)4)18(22)27-21(17)8-6-7-9-21/h10-11H,5-9H2,1-4H3 |
| InChIKey | RJPNOAAYSWJKBP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate?
The IUPAC name of 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate (CID 56851413) is 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate.
What is the SMILES notation for 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate?
The canonical SMILES for 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate is CCOC(=O)C(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)OC12CCCC2.
What is the InChIKey of 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate?
The InChIKey is RJPNOAAYSWJKBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O6/c1-5-25-19(23)20(24)26-17-16(15-13(3)10-12(2)11-14(15)4)18(22)27-21(17)8-6-7-9-21/h10-11H,5-9H2,1-4H3.
What are the key properties of 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate?
1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate has a molecular weight of 372.42 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] oxalate is sourced from PubChem (CID 56851413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).