About 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate
2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate (PubChem CID 56851570) has the molecular formula C22H22O6
and a molecular weight of 382.41 g/mol. Its IUPAC name is 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate.
Molecular Properties
| Compound Name | 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate |
| PubChem CID | 56851570 |
| Molecular Formula | C22H22O6 |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate |
| SMILES | C#CCOC(=O)C(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)OC12CCCC2 |
| InChI | InChI=1S/C22H22O6/c1-5-10-26-20(24)21(25)27-18-17(16-14(3)11-13(2)12-15(16)4)19(23)28-22(18)8-6-7-9-22/h1,11-12H,6-10H2,2-4H3 |
| InChIKey | FTDODGRQCSINSG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate?
The IUPAC name of 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate (CID 56851570) is 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate.
What is the SMILES notation for 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate?
The canonical SMILES for 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate is C#CCOC(=O)C(=O)OC1=C(c2c(C)cc(C)cc2C)C(=O)OC12CCCC2.
What is the InChIKey of 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate?
The InChIKey is FTDODGRQCSINSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O6/c1-5-10-26-20(24)21(25)27-18-17(16-14(3)11-13(2)12-15(16)4)19(23)28-22(18)8-6-7-9-22/h1,11-12H,6-10H2,2-4H3.
What are the key properties of 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate?
2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate has a molecular weight of 382.41 g/mol, XLogP of 2.91, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[2-oxo-3-(2,4,6-trimethylphenyl)-1-oxaspiro[4.4]non-3-en-4-yl] 1-O-prop-2-ynyl oxalate is sourced from PubChem (CID 56851570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).