C21H26FN5O2 — CID 56851850
(7S,9aR)-7-[(2S)-butan-2-yl]-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56851850) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is (7S,9aR)-7-[(2S)-butan-2-yl]-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-[(2S)-butan-2-yl]-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56851850 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (7S,9aR)-7-[(2S)-butan-2-yl]-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | CC[C@H](C)[C@@H]1NC(=O)[C@H]2CN(Cc3cnn(-c4ccc(F)cc4)c3)CCN2C1=O |
| InChI | InChI=1S/C21H26FN5O2/c1-3-14(2)19-21(29)26-9-8-25(13-18(26)20(28)24-19)11-15-10-23-27(12-15)17-6-4-16(22)5-7-17/h4-7,10,12,14,18-19H,3,8-9,11,13H2,1-2H3,(H,24,28)/t14-,18+,19-/m0/s1 |
| InChIKey | HUCKUSSETVTAAZ-KYNGSXCRSA-N |
| XLogP | 1.57 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |