C21H27FN6O2 — CID 56851952
(7S,9aR)-7-(4-aminobutyl)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56851952) has the molecular formula C21H27FN6O2 and a molecular weight of 414.49 g/mol. Its IUPAC name is (7S,9aR)-7-(4-aminobutyl)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-(4-aminobutyl)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56851952 |
| Molecular Formula | C21H27FN6O2 |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (7S,9aR)-7-(4-aminobutyl)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | NCCCC[C@@H]1NC(=O)[C@H]2CN(Cc3cnn(-c4ccc(F)cc4)c3)CCN2C1=O |
| InChI | InChI=1S/C21H27FN6O2/c22-16-4-6-17(7-5-16)28-13-15(11-24-28)12-26-9-10-27-19(14-26)20(29)25-18(21(27)30)3-1-2-8-23/h4-7,11,13,18-19H,1-3,8-10,12,14,23H2,(H,25,29)/t18-,19+/m0/s1 |
| InChIKey | QDMAKWPNNQDVAQ-RBUKOAKNSA-N |
| XLogP | 0.65 |
| TPSA | 96.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|