C22H26N4O3 — CID 56851956
N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]naphthalene-1-carboxamide (PubChem CID 56851956) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]naphthalene-1-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 56851956 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(4-aminobutyl)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-7-yl]naphthalene-1-carboxamide |
| SMILES | NCCCC[C@@H]1NC(=O)[C@@H]2C[C@H](NC(=O)c3cccc4ccccc34)CN2C1=O |
| InChI | InChI=1S/C22H26N4O3/c23-11-4-3-10-18-22(29)26-13-15(12-19(26)21(28)25-18)24-20(27)17-9-5-7-14-6-1-2-8-16(14)17/h1-2,5-9,15,18-19H,3-4,10-13,23H2,(H,24,27)(H,25,28)/t15-,18-,19-/m0/s1 |
| InChIKey | HXSJETHMUODLCK-SNRMKQJTSA-N |
| XLogP | 1.17 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|