C19H22FN5O2 — CID 56852191
(7S,9aR)-2-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56852191) has the molecular formula C19H22FN5O2 and a molecular weight of 371.42 g/mol. Its IUPAC name is (7S,9aR)-2-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-2-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56852191 |
| Molecular Formula | C19H22FN5O2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | (7S,9aR)-2-[[1-(2-fluorophenyl)pyrazol-4-yl]methyl]-7,8-dimethyl-3,4,7,9a-tetrahydro-1H-pyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@H]1C(=O)N2CCN(Cc3cnn(-c4ccccc4F)c3)C[C@@H]2C(=O)N1C |
| InChI | InChI=1S/C19H22FN5O2/c1-13-18(26)24-8-7-23(12-17(24)19(27)22(13)2)10-14-9-21-25(11-14)16-6-4-3-5-15(16)20/h3-6,9,11,13,17H,7-8,10,12H2,1-2H3/t13-,17+/m0/s1 |
| InChIKey | VTOJWNZCNIGACU-SUMWQHHRSA-N |
| XLogP | 0.88 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |