C19H22FN5O3 — CID 56852849
(7R,9aR)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-7-[(1S)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 56852849) has the molecular formula C19H22FN5O3 and a molecular weight of 387.42 g/mol. Its IUPAC name is (7R,9aR)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-7-[(1S)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7R,9aR)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-7-[(1S)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 56852849 |
| Molecular Formula | C19H22FN5O3 |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (7R,9aR)-2-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-7-[(1S)-1-hydroxyethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@H](O)[C@H]1NC(=O)[C@H]2CN(Cc3cnn(-c4ccc(F)cc4)c3)CCN2C1=O |
| InChI | InChI=1S/C19H22FN5O3/c1-12(26)17-19(28)24-7-6-23(11-16(24)18(27)22-17)9-13-8-21-25(10-13)15-4-2-14(20)3-5-15/h2-5,8,10,12,16-17,26H,6-7,9,11H2,1H3,(H,22,27)/t12-,16+,17+/m0/s1 |
| InChIKey | ISJJATOKLKNXLR-JCURWCKSSA-N |
| XLogP | -0.10 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |