C19H26N4O3 — CID 56852903
(7S,9aR)-N-benzyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 56852903) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is (7S,9aR)-N-benzyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (7S,9aR)-N-benzyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 56852903 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (7S,9aR)-N-benzyl-7-(2-methylpropyl)-6,9-dioxo-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H]2CN(C(=O)NCc3ccccc3)CCN2C1=O |
| InChI | InChI=1S/C19H26N4O3/c1-13(2)10-15-18(25)23-9-8-22(12-16(23)17(24)21-15)19(26)20-11-14-6-4-3-5-7-14/h3-7,13,15-16H,8-12H2,1-2H3,(H,20,26)(H,21,24)/t15-,16+/m0/s1 |
| InChIKey | KATCLEKPOQCWNP-JKSUJKDBSA-N |
| XLogP | 0.95 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |