C26H35N5O2 — CID 56852967
(3R,5S)-N-[3-(dimethylamino)propyl]-1-(1H-indol-3-ylmethyl)-5-(pyridin-3-yloxymethyl)piperidine-3-carboxamide (PubChem CID 56852967) has the molecular formula C26H35N5O2 and a molecular weight of 449.60 g/mol. Its IUPAC name is (3R,5S)-N-[3-(dimethylamino)propyl]-1-(1H-indol-3-ylmethyl)-5-(pyridin-3-yloxymethyl)piperidine-3-carboxamide.
| Compound Name | (3R,5S)-N-[3-(dimethylamino)propyl]-1-(1H-indol-3-ylmethyl)-5-(pyridin-3-yloxymethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 56852967 |
| Molecular Formula | C26H35N5O2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | (3R,5S)-N-[3-(dimethylamino)propyl]-1-(1H-indol-3-ylmethyl)-5-(pyridin-3-yloxymethyl)piperidine-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)[C@@H]1C[C@H](COc2cccnc2)CN(Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C26H35N5O2/c1-30(2)12-6-11-28-26(32)21-13-20(19-33-23-7-5-10-27-15-23)16-31(17-21)18-22-14-29-25-9-4-3-8-24(22)25/h3-5,7-10,14-15,20-21,29H,6,11-13,16-19H2,1-2H3,(H,28,32)/t20-,21+/m0/s1 |
| InChIKey | FIVJXSSAJROXQO-LEWJYISDSA-N |
| XLogP | 3.15 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|