About 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol
6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol (PubChem CID 56852993) has the molecular formula C21H36N2O
and a molecular weight of 332.53 g/mol. Its IUPAC name is 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol.
Molecular Properties
| Compound Name | 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol |
| PubChem CID | 56852993 |
| Molecular Formula | C21H36N2O |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.28 |
| IUPAC Name | 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol |
| SMILES | Cc1cc(C)cc(N2CCC(NC(C)CCCC(C)(C)O)CC2)c1 |
| InChI | InChI=1S/C21H36N2O/c1-16-13-17(2)15-20(14-16)23-11-8-19(9-12-23)22-18(3)7-6-10-21(4,5)24/h13-15,18-19,22,24H,6-12H2,1-5H3 |
| InChIKey | KFMSOJKJEYMZKO-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol?
The IUPAC name of 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol (CID 56852993) is 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol.
What is the SMILES notation for 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol?
The canonical SMILES for 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol is Cc1cc(C)cc(N2CCC(NC(C)CCCC(C)(C)O)CC2)c1.
What is the InChIKey of 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol?
The InChIKey is KFMSOJKJEYMZKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N2O/c1-16-13-17(2)15-20(14-16)23-11-8-19(9-12-23)22-18(3)7-6-10-21(4,5)24/h13-15,18-19,22,24H,6-12H2,1-5H3.
What are the key properties of 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol?
6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol has a molecular weight of 332.53 g/mol, XLogP of 4.19, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[1-(3,5-dimethylphenyl)piperidin-4-yl]amino]-2-methylheptan-2-ol is sourced from PubChem (CID 56852993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).