C18H21ClN4O3 — CID 56853956
1-(4-chloro-2-methylphenyl)-3-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]urea (PubChem CID 56853956) has the molecular formula C18H21ClN4O3 and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]urea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]urea |
|---|---|
| PubChem CID | 56853956 |
| Molecular Formula | C18H21ClN4O3 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-[(3S,5S,9R)-2,8-dioxo-1,7-diazatricyclo[7.3.0.03,7]dodecan-5-yl]urea |
| SMILES | Cc1cc(Cl)ccc1NC(=O)N[C@H]1C[C@H]2C(=O)N3CCC[C@@H]3C(=O)N2C1 |
| InChI | InChI=1S/C18H21ClN4O3/c1-10-7-11(19)4-5-13(10)21-18(26)20-12-8-15-17(25)22-6-2-3-14(22)16(24)23(15)9-12/h4-5,7,12,14-15H,2-3,6,8-9H2,1H3,(H2,20,21,26)/t12-,14+,15-/m0/s1 |
| InChIKey | GKEITBUOBBSSCH-CFVMTHIKSA-N |
| XLogP | 1.74 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |