C15H13ClFN5O — CID 56854202
3-[(2-chloro-6-fluorophenyl)methyl]-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-1,2,4-oxadiazole (PubChem CID 56854202) has the molecular formula C15H13ClFN5O and a molecular weight of 333.75 g/mol. Its IUPAC name is 3-[(2-chloro-6-fluorophenyl)methyl]-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[(2-chloro-6-fluorophenyl)methyl]-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 56854202 |
| Molecular Formula | C15H13ClFN5O |
| Molecular Weight | 333.75 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 3-[(2-chloro-6-fluorophenyl)methyl]-5-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)-1,2,4-oxadiazole |
| SMILES | Fc1cccc(Cl)c1Cc1noc(-c2nnc3n2CCCC3)n1 |
| InChI | InChI=1S/C15H13ClFN5O/c16-10-4-3-5-11(17)9(10)8-12-18-15(23-21-12)14-20-19-13-6-1-2-7-22(13)14/h3-5H,1-2,6-8H2 |
| InChIKey | QPONCANUNMLABA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |